About azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium
azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium (PubChem CID 58315520) has the molecular formula C15H22N2O2Y-2
and a molecular weight of 351.26 g/mol. Its IUPAC name is azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium.
Molecular Properties
| Compound Name | azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium |
| PubChem CID | 58315520 |
| Molecular Formula | C15H22N2O2Y-2 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1cc[c-]cc1.[NH2-].[Y] |
| InChI | InChI=1S/C15H20NO2.H2N.Y/c1-15(2,3)18-14(17)16-11-7-10-13(16)12-8-5-4-6-9-12;;/h5-6,8-9,13H,7,10-11H2,1-3H3;1H2;/q2*-1; |
| InChIKey | BGOMJSKYEOPHDQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium?
The IUPAC name of azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium (CID 58315520) is azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium.
What is the SMILES notation for azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium?
The canonical SMILES for azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium is CC(C)(C)OC(=O)N1CCCC1c1cc[c-]cc1.[NH2-].[Y].
What is the InChIKey of azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium?
The InChIKey is BGOMJSKYEOPHDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20NO2.H2N.Y/c1-15(2,3)18-14(17)16-11-7-10-13(16)12-8-5-4-6-9-12;;/h5-6,8-9,13H,7,10-11H2,1-3H3;1H2;/q2*-1;.
What are the key properties of azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium?
azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium has a molecular weight of 351.26 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;tert-butyl 2-phenylpyrrolidine-1-carboxylate;yttrium is sourced from PubChem (CID 58315520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).