C21H25N3O2 — CID 58315539
2-(4-morpholin-2-ylphenyl)-1-(6-pyrrolidin-1-yl-3-pyridinyl)ethanone (PubChem CID 58315539) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-(4-morpholin-2-ylphenyl)-1-(6-pyrrolidin-1-yl-3-pyridinyl)ethanone.
| Compound Name | 2-(4-morpholin-2-ylphenyl)-1-(6-pyrrolidin-1-yl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 58315539 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-(4-morpholin-2-ylphenyl)-1-(6-pyrrolidin-1-yl-3-pyridinyl)ethanone |
| SMILES | O=C(Cc1ccc(C2CNCCO2)cc1)c1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C21H25N3O2/c25-19(18-7-8-21(23-14-18)24-10-1-2-11-24)13-16-3-5-17(6-4-16)20-15-22-9-12-26-20/h3-8,14,20,22H,1-2,9-13,15H2 |
| InChIKey | WYWTWXVPQYTDPK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |