C19H19F3N2O — CID 58315615
2-[4-[(3R)-piperidin-3-yl]phenyl]-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone (PubChem CID 58315615) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-[4-[(3R)-piperidin-3-yl]phenyl]-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone.
| Compound Name | 2-[4-[(3R)-piperidin-3-yl]phenyl]-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 58315615 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[4-[(3R)-piperidin-3-yl]phenyl]-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone |
| SMILES | O=C(Cc1ccc([C@H]2CCCNC2)cc1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C19H19F3N2O/c20-19(21,22)18-8-7-16(12-24-18)17(25)10-13-3-5-14(6-4-13)15-2-1-9-23-11-15/h3-8,12,15,23H,1-2,9-11H2/t15-/m0/s1 |
| InChIKey | MRYIHDRNFXRQCE-HNNXBMFYSA-N |
| XLogP | 3.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |