C20H23FN2O — CID 58315755
4-fluoro-N-[4-(2-piperidin-2-ylethyl)phenyl]benzamide (PubChem CID 58315755) has the molecular formula C20H23FN2O and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-fluoro-N-[4-(2-piperidin-2-ylethyl)phenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-(2-piperidin-2-ylethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58315755 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 4-fluoro-N-[4-(2-piperidin-2-ylethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CCC2CCCCN2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN2O/c21-17-9-7-16(8-10-17)20(24)23-19-12-5-15(6-13-19)4-11-18-3-1-2-14-22-18/h5-10,12-13,18,22H,1-4,11,14H2,(H,23,24) |
| InChIKey | AFCKSHLXPSBSGE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |