C20H18Br2O2 — CID 58315873
2-bromo-1-[4-[4-(2-bromoacetyl)-5,6,7,8-tetrahydronaphthalen-1-yl]phenyl]ethanone (PubChem CID 58315873) has the molecular formula C20H18Br2O2 and a molecular weight of 450.17 g/mol. Its IUPAC name is 2-bromo-1-[4-[4-(2-bromoacetyl)-5,6,7,8-tetrahydronaphthalen-1-yl]phenyl]ethanone.
| Compound Name | 2-bromo-1-[4-[4-(2-bromoacetyl)-5,6,7,8-tetrahydronaphthalen-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 58315873 |
| Molecular Formula | C20H18Br2O2 |
| Molecular Weight | 450.17 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | 2-bromo-1-[4-[4-(2-bromoacetyl)-5,6,7,8-tetrahydronaphthalen-1-yl]phenyl]ethanone |
| SMILES | O=C(CBr)c1ccc(-c2ccc(C(=O)CBr)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C20H18Br2O2/c21-11-19(23)14-7-5-13(6-8-14)15-9-10-18(20(24)12-22)17-4-2-1-3-16(15)17/h5-10H,1-4,11-12H2 |
| InChIKey | MCNJIIMHEAUAJP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.17 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|