C34H40BN3O4 — CID 58315994
tert-butyl (2S)-2-[5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-1-yl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58315994) has the molecular formula C34H40BN3O4 and a molecular weight of 565.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-1-yl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-1-yl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58315994 |
| Molecular Formula | C34H40BN3O4 |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | tert-butyl (2S)-2-[5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-1-yl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc(-c2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3ccccc23)[nH]1 |
| InChI | InChI=1S/C34H40BN3O4/c1-32(2,3)40-31(39)38-20-10-13-29(38)30-36-21-28(37-30)27-19-18-24(25-11-8-9-12-26(25)27)22-14-16-23(17-15-22)35-41-33(4,5)34(6,7)42-35/h8-9,11-12,14-19,21,29H,10,13,20H2,1-7H3,(H,36,37)/t29-/m0/s1 |
| InChIKey | OCILCDNYLXWWLL-LJAQVGFWSA-N |
| XLogP | 7.27 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|