C27H35B2NO4 — CID 58316064
2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-indole (PubChem CID 58316064) has the molecular formula C27H35B2NO4 and a molecular weight of 459.20 g/mol. Its IUPAC name is 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-indole.
| Compound Name | 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-indole |
|---|---|
| PubChem CID | 58316064 |
| Molecular Formula | C27H35B2NO4 |
| Molecular Weight | 459.20 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-indole |
| SMILES | Cc1cc2c(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)ccc(B3OC(C)(C)C(C)(C)O3)c2[nH]1 |
| InChI | InChI=1S/C27H35B2NO4/c1-17-16-21-20(14-15-22(23(21)30-17)29-33-26(6,7)27(8,9)34-29)18-10-12-19(13-11-18)28-31-24(2,3)25(4,5)32-28/h10-16,30H,1-9H3 |
| InChIKey | SAZSQGWVZMLWOQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 52.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|