C24H22BrNO2 — CID 58316402
1-[(2S)-2-[2-(6-bromonaphthalen-2-yl)acetyl]pyrrolidin-1-yl]-2-phenylethanone (PubChem CID 58316402) has the molecular formula C24H22BrNO2 and a molecular weight of 436.35 g/mol. Its IUPAC name is 1-[(2S)-2-[2-(6-bromonaphthalen-2-yl)acetyl]pyrrolidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[(2S)-2-[2-(6-bromonaphthalen-2-yl)acetyl]pyrrolidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 58316402 |
| Molecular Formula | C24H22BrNO2 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 1-[(2S)-2-[2-(6-bromonaphthalen-2-yl)acetyl]pyrrolidin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccc2cc(Br)ccc2c1)[C@@H]1CCCN1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H22BrNO2/c25-21-11-10-19-13-18(8-9-20(19)16-21)14-23(27)22-7-4-12-26(22)24(28)15-17-5-2-1-3-6-17/h1-3,5-6,8-11,13,16,22H,4,7,12,14-15H2/t22-/m0/s1 |
| InChIKey | HXZQDFOJHWJNAU-QFIPXVFZSA-N |
| XLogP | 4.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |