C13H12ClN5 — CID 58316679
4-chloro-1-(2-phenylethyl)pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 58316679) has the molecular formula C13H12ClN5 and a molecular weight of 273.73 g/mol. Its IUPAC name is 4-chloro-1-(2-phenylethyl)pyrazolo[5,4-d]pyrimidin-6-amine.
| Compound Name | 4-chloro-1-(2-phenylethyl)pyrazolo[5,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 58316679 |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-chloro-1-(2-phenylethyl)pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | Nc1nc(Cl)c2cnn(CCc3ccccc3)c2n1 |
| InChI | InChI=1S/C13H12ClN5/c14-11-10-8-16-19(12(10)18-13(15)17-11)7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,15,17,18) |
| InChIKey | CJSVBWFEHILFHJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |