C20H20N2O5 — CID 58317048
N-[4-(4-butyl-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-3-yl)phenyl]acetamide (PubChem CID 58317048) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[4-(4-butyl-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-3-yl)phenyl]acetamide.
| Compound Name | N-[4-(4-butyl-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 58317048 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[4-(4-butyl-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-3-yl)phenyl]acetamide |
| SMILES | CCCCc1c2c(oc(=O)c1-c1ccc(NC(C)=O)cc1)CC(=O)NC2=O |
| InChI | InChI=1S/C20H20N2O5/c1-3-4-5-14-17(12-6-8-13(9-7-12)21-11(2)23)20(26)27-15-10-16(24)22-19(25)18(14)15/h6-9H,3-5,10H2,1-2H3,(H,21,23)(H,22,24,25) |
| InChIKey | GKEJHYDYZMFSMP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|