C21H16FNO4 — CID 58317145
4-[[4-(2-fluorophenyl)phenyl]methyl]-8,8a-dihydro-4aH-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317145) has the molecular formula C21H16FNO4 and a molecular weight of 365.36 g/mol. Its IUPAC name is 4-[[4-(2-fluorophenyl)phenyl]methyl]-8,8a-dihydro-4aH-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-[[4-(2-fluorophenyl)phenyl]methyl]-8,8a-dihydro-4aH-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317145 |
| Molecular Formula | C21H16FNO4 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-[[4-(2-fluorophenyl)phenyl]methyl]-8,8a-dihydro-4aH-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1CC2OC(=O)C=C(Cc3ccc(-c4ccccc4F)cc3)C2C(=O)N1 |
| InChI | InChI=1S/C21H16FNO4/c22-16-4-2-1-3-15(16)13-7-5-12(6-8-13)9-14-10-19(25)27-17-11-18(24)23-21(26)20(14)17/h1-8,10,17,20H,9,11H2,(H,23,24,26) |
| InChIKey | YMALDJWTEBCMOU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|