C18H15N3O4 — CID 58317214
4-(5-butyl-2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-6-yl)benzonitrile (PubChem CID 58317214) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 4-(5-butyl-2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-6-yl)benzonitrile.
| Compound Name | 4-(5-butyl-2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-6-yl)benzonitrile |
|---|---|
| PubChem CID | 58317214 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-(5-butyl-2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-6-yl)benzonitrile |
| SMILES | CCCCc1c(-c2ccc(C#N)cc2)c(=O)oc2[nH]c(=O)[nH]c(=O)c12 |
| InChI | InChI=1S/C18H15N3O4/c1-2-3-4-12-13(11-7-5-10(9-19)6-8-11)17(23)25-16-14(12)15(22)20-18(24)21-16/h5-8H,2-4H2,1H3,(H2,20,21,22,24) |
| InChIKey | DNMWYZWFPSALDJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |