C22H22N2O5 — CID 58317227
N-[4-[4-(2-cyclobutylethyl)-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-3-yl]phenyl]acetamide (PubChem CID 58317227) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[4-[4-(2-cyclobutylethyl)-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(2-cyclobutylethyl)-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 58317227 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[4-[4-(2-cyclobutylethyl)-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2c(CCC3CCC3)c3c(oc2=O)CC(=O)NC3=O)cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-12(25)23-15-8-6-14(7-9-15)19-16(10-5-13-3-2-4-13)20-17(29-22(19)28)11-18(26)24-21(20)27/h6-9,13H,2-5,10-11H2,1H3,(H,23,25)(H,24,26,27) |
| InChIKey | TXIKZXSONNXIJL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|