C19H18N2O6 — CID 58317247
benzyl N-[3-(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)propyl]carbamate (PubChem CID 58317247) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is benzyl N-[3-(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)propyl]carbamate.
| Compound Name | benzyl N-[3-(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)propyl]carbamate |
|---|---|
| PubChem CID | 58317247 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | benzyl N-[3-(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)propyl]carbamate |
| SMILES | O=C1Cc2oc(=O)cc(CCCNC(=O)OCc3ccccc3)c2C(=O)N1 |
| InChI | InChI=1S/C19H18N2O6/c22-15-10-14-17(18(24)21-15)13(9-16(23)27-14)7-4-8-20-19(25)26-11-12-5-2-1-3-6-12/h1-3,5-6,9H,4,7-8,10-11H2,(H,20,25)(H,21,22,24) |
| InChIKey | MXVLJIYBMIEOLK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|