C35H40FN5O5 — CID 58317597
tert-butyl 2-[(1R,2R)-2-[[2-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-3-oxo-4-pyrazolo[1,5-a]pyridin-3-yl-1H-pyrrolo[3,4-c]pyridin-6-yl]amino]cyclohexyl]acetate (PubChem CID 58317597) has the molecular formula C35H40FN5O5 and a molecular weight of 629.73 g/mol. Its IUPAC name is tert-butyl 2-[(1R,2R)-2-[[2-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-3-oxo-4-pyrazolo[1,5-a]pyridin-3-yl-1H-pyrrolo[3,4-c]pyridin-6-yl]amino]cyclohexyl]acetate.
| Compound Name | tert-butyl 2-[(1R,2R)-2-[[2-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-3-oxo-4-pyrazolo[1,5-a]pyridin-3-yl-1H-pyrrolo[3,4-c]pyridin-6-yl]amino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 58317597 |
| Molecular Formula | C35H40FN5O5 |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | tert-butyl 2-[(1R,2R)-2-[[2-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-3-oxo-4-pyrazolo[1,5-a]pyridin-3-yl-1H-pyrrolo[3,4-c]pyridin-6-yl]amino]cyclohexyl]acetate |
| SMILES | COc1ccc(CN2Cc3c(F)c(N[C@@H]4CCCC[C@@H]4CC(=O)OC(C)(C)C)nc(-c4cnn5ccccc45)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C35H40FN5O5/c1-35(2,3)46-29(42)16-21-10-6-7-11-26(21)38-33-31(36)25-20-40(19-22-13-14-23(44-4)17-28(22)45-5)34(43)30(25)32(39-33)24-18-37-41-15-9-8-12-27(24)41/h8-9,12-15,17-18,21,26H,6-7,10-11,16,19-20H2,1-5H3,(H,38,39)/t21-,26-/m1/s1 |
| InChIKey | SYIMAPSCCGWKBA-QFQXNSOFSA-N |
| XLogP | 6.41 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |