C26H21N3O2S — CID 58317784
4-[2-(4-methylsulfonylphenyl)benzimidazol-1-yl]-N-phenylaniline (PubChem CID 58317784) has the molecular formula C26H21N3O2S and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-[2-(4-methylsulfonylphenyl)benzimidazol-1-yl]-N-phenylaniline.
| Compound Name | 4-[2-(4-methylsulfonylphenyl)benzimidazol-1-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 58317784 |
| Molecular Formula | C26H21N3O2S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 4-[2-(4-methylsulfonylphenyl)benzimidazol-1-yl]-N-phenylaniline |
| SMILES | CS(=O)(=O)c1ccc(-c2nc3ccccc3n2-c2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H21N3O2S/c1-32(30,31)23-17-11-19(12-18-23)26-28-24-9-5-6-10-25(24)29(26)22-15-13-21(14-16-22)27-20-7-3-2-4-8-20/h2-18,27H,1H3 |
| InChIKey | QNOWFSKXVDSTEK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |