About N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine
N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine (PubChem CID 58317819) has the molecular formula C17H35N3
and a molecular weight of 281.49 g/mol. Its IUPAC name is N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine |
| PubChem CID | 58317819 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine |
| SMILES | CN(CCN1C2CCC1CN(C(C)(C)C)C2)C(C)(C)C |
| InChI | InChI=1S/C17H35N3/c1-16(2,3)18(7)10-11-20-14-8-9-15(20)13-19(12-14)17(4,5)6/h14-15H,8-13H2,1-7H3 |
| InChIKey | HNEGLYBWGWIVNJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine?
The IUPAC name of N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine (CID 58317819) is N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine.
What is the SMILES notation for N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine?
The canonical SMILES for N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine is CN(CCN1C2CCC1CN(C(C)(C)C)C2)C(C)(C)C.
What is the InChIKey of N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine?
The InChIKey is HNEGLYBWGWIVNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N3/c1-16(2,3)18(7)10-11-20-14-8-9-15(20)13-19(12-14)17(4,5)6/h14-15H,8-13H2,1-7H3.
What are the key properties of N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine?
N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine has a molecular weight of 281.49 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-tert-butyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethyl]-N,2-dimethylpropan-2-amine is sourced from PubChem (CID 58317819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).