About 4,4-dihydroxybutan-1-olate
4,4-dihydroxybutan-1-olate (PubChem CID 58318289) has the molecular formula C4H9O3-
and a molecular weight of 105.11 g/mol. Its IUPAC name is 4,4-dihydroxybutan-1-olate.
Molecular Properties
| Compound Name | 4,4-dihydroxybutan-1-olate |
| PubChem CID | 58318289 |
| Molecular Formula | C4H9O3- |
| Molecular Weight | 105.11 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 4,4-dihydroxybutan-1-olate |
| SMILES | [O-]CCCC(O)O |
| InChI | InChI=1S/C4H9O3/c5-3-1-2-4(6)7/h4,6-7H,1-3H2/q-1 |
| InChIKey | LBLDEESACJQXPO-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.11 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dihydroxybutan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dihydroxybutan-1-olate?
The IUPAC name of 4,4-dihydroxybutan-1-olate (CID 58318289) is 4,4-dihydroxybutan-1-olate.
What is the SMILES notation for 4,4-dihydroxybutan-1-olate?
The canonical SMILES for 4,4-dihydroxybutan-1-olate is [O-]CCCC(O)O.
What is the InChIKey of 4,4-dihydroxybutan-1-olate?
The InChIKey is LBLDEESACJQXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O3/c5-3-1-2-4(6)7/h4,6-7H,1-3H2/q-1.
What are the key properties of 4,4-dihydroxybutan-1-olate?
4,4-dihydroxybutan-1-olate has a molecular weight of 105.11 g/mol, XLogP of -1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dihydroxybutan-1-olate is sourced from PubChem (CID 58318289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).