C16H23NO — CID 58318352
5-(4,4-dimethylpentyl)-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 58318352) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-(4,4-dimethylpentyl)-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(4,4-dimethylpentyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 58318352 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 5-(4,4-dimethylpentyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | CC(C)(C)CCCC1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C16H23NO/c1-16(2,3)11-7-10-14-12-15(17-18-14)13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-12H2,1-3H3 |
| InChIKey | BZKMDNHVEFZMOG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |