C16H26 — CID 58318425
(3S,7R)-4-(3,3-dimethylbutyl)-8,8-dimethyltricyclo[5.1.0.01,3]oct-4-ene (PubChem CID 58318425) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (3S,7R)-4-(3,3-dimethylbutyl)-8,8-dimethyltricyclo[5.1.0.01,3]oct-4-ene.
| Compound Name | (3S,7R)-4-(3,3-dimethylbutyl)-8,8-dimethyltricyclo[5.1.0.01,3]oct-4-ene |
|---|---|
| PubChem CID | 58318425 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (3S,7R)-4-(3,3-dimethylbutyl)-8,8-dimethyltricyclo[5.1.0.01,3]oct-4-ene |
| SMILES | CC(C)(C)CCC1=CC[C@@H]2C(C)(C)C23C[C@@H]13 |
| InChI | InChI=1S/C16H26/c1-14(2,3)9-8-11-6-7-13-15(4,5)16(13)10-12(11)16/h6,12-13H,7-10H2,1-5H3/t12-,13+,16?/m0/s1 |
| InChIKey | OFYDPWBFPVWMQQ-FTLRAWMYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|