C7H10NO2- — CID 58318539
6-methyl-2,3,4,5-tetrahydropyridine-4-carboxylate (PubChem CID 58318539) has the molecular formula C7H10NO2- and a molecular weight of 140.16 g/mol. Its IUPAC name is 6-methyl-2,3,4,5-tetrahydropyridine-4-carboxylate.
| Compound Name | 6-methyl-2,3,4,5-tetrahydropyridine-4-carboxylate |
|---|---|
| PubChem CID | 58318539 |
| Molecular Formula | C7H10NO2- |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 6-methyl-2,3,4,5-tetrahydropyridine-4-carboxylate |
| SMILES | CC1=NCCC(C(=O)[O-])C1 |
| InChI | InChI=1S/C7H11NO2/c1-5-4-6(7(9)10)2-3-8-5/h6H,2-4H2,1H3,(H,9,10)/p-1 |
| InChIKey | HTBHAQZLYRQNPX-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |