About 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid
2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid (PubChem CID 58318541) has the molecular formula C7H10NO2+
and a molecular weight of 140.16 g/mol. Its IUPAC name is 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid |
| PubChem CID | 58318541 |
| Molecular Formula | C7H10NO2+ |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid |
| SMILES | C[C+]1CC(C(=O)O)CC=N1 |
| InChI | InChI=1S/C7H9NO2/c1-5-4-6(7(9)10)2-3-8-5/h3,6H,2,4H2,1H3/p+1 |
| InChIKey | MAZYVXIOBDJTLY-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid?
The IUPAC name of 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid (CID 58318541) is 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid.
What is the SMILES notation for 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid?
The canonical SMILES for 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid is C[C+]1CC(C(=O)O)CC=N1.
What is the InChIKey of 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid?
The InChIKey is MAZYVXIOBDJTLY-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H9NO2/c1-5-4-6(7(9)10)2-3-8-5/h3,6H,2,4H2,1H3/p+1.
What are the key properties of 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid?
2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid has a molecular weight of 140.16 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5-dihydro-3H-pyridin-2-ylium-4-carboxylic acid is sourced from PubChem (CID 58318541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).