About 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole
2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole (PubChem CID 58318544) has the molecular formula C24H19F2N3O
and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole |
| PubChem CID | 58318544 |
| Molecular Formula | C24H19F2N3O |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole |
| SMILES | Cc1ccc(Oc2nc3c(F)c(-c4ccc5c(ccn5C)c4)c(F)cc3[nH]2)cc1C |
| InChI | InChI=1S/C24H19F2N3O/c1-13-4-6-17(10-14(13)2)30-24-27-19-12-18(25)21(22(26)23(19)28-24)16-5-7-20-15(11-16)8-9-29(20)3/h4-12H,1-3H3,(H,27,28) |
| InChIKey | AEZWILPCCZOQPE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole?
The IUPAC name of 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole (CID 58318544) is 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole.
What is the SMILES notation for 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole?
The canonical SMILES for 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole is Cc1ccc(Oc2nc3c(F)c(-c4ccc5c(ccn5C)c4)c(F)cc3[nH]2)cc1C.
What is the InChIKey of 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole?
The InChIKey is AEZWILPCCZOQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F2N3O/c1-13-4-6-17(10-14(13)2)30-24-27-19-12-18(25)21(22(26)23(19)28-24)16-5-7-20-15(11-16)8-9-29(20)3/h4-12H,1-3H3,(H,27,28).
What are the key properties of 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole?
2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole has a molecular weight of 403.43 g/mol, XLogP of 6.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylphenoxy)-4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazole is sourced from PubChem (CID 58318544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).