C24H15F2N3O2 — CID 58318633
2-[1-[2-(3,5-difluorophenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 58318633) has the molecular formula C24H15F2N3O2 and a molecular weight of 415.40 g/mol. Its IUPAC name is 2-[1-[2-(3,5-difluorophenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[2-(3,5-difluorophenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58318633 |
| Molecular Formula | C24H15F2N3O2 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[1-[2-(3,5-difluorophenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1cc2ncccc2nc1-c1cc(F)cc(F)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H15F2N3O2/c1-13(29-23(30)17-5-2-3-6-18(17)24(29)31)19-12-21-20(7-4-8-27-21)28-22(19)14-9-15(25)11-16(26)10-14/h2-13H,1H3 |
| InChIKey | GSKLOHUAIVXSAL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|