C18H14ClFN4O — CID 58318782
2-(4-chloro-2-pyridinyl)-1-[4-fluoro-3-[methyl(pyrimidin-5-yl)amino]phenyl]ethanone (PubChem CID 58318782) has the molecular formula C18H14ClFN4O and a molecular weight of 356.79 g/mol. Its IUPAC name is 2-(4-chloro-2-pyridinyl)-1-[4-fluoro-3-[methyl(pyrimidin-5-yl)amino]phenyl]ethanone.
| Compound Name | 2-(4-chloro-2-pyridinyl)-1-[4-fluoro-3-[methyl(pyrimidin-5-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 58318782 |
| Molecular Formula | C18H14ClFN4O |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-(4-chloro-2-pyridinyl)-1-[4-fluoro-3-[methyl(pyrimidin-5-yl)amino]phenyl]ethanone |
| SMILES | CN(c1cncnc1)c1cc(C(=O)Cc2cc(Cl)ccn2)ccc1F |
| InChI | InChI=1S/C18H14ClFN4O/c1-24(15-9-21-11-22-10-15)17-6-12(2-3-16(17)20)18(25)8-14-7-13(19)4-5-23-14/h2-7,9-11H,8H2,1H3 |
| InChIKey | OENGLWPTYFYGIJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |