About methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid
methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid (PubChem CID 58318977) has the molecular formula C24H24BN3O2
and a molecular weight of 397.29 g/mol. Its IUPAC name is methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid.
Molecular Properties
| Compound Name | methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid |
| PubChem CID | 58318977 |
| Molecular Formula | C24H24BN3O2 |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid |
| SMILES | CB(O)N1CCC2(CC1)C(=O)N(c1ccc(-c3ccccc3)cc1)c1ncccc12 |
| InChI | InChI=1S/C24H24BN3O2/c1-25(30)27-16-13-24(14-17-27)21-8-5-15-26-22(21)28(23(24)29)20-11-9-19(10-12-20)18-6-3-2-4-7-18/h2-12,15,30H,13-14,16-17H2,1H3 |
| InChIKey | ZBLFEWHIFDDYQL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid?
The IUPAC name of methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid (CID 58318977) is methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid.
What is the SMILES notation for methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid?
The canonical SMILES for methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid is CB(O)N1CCC2(CC1)C(=O)N(c1ccc(-c3ccccc3)cc1)c1ncccc12.
What is the InChIKey of methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid?
The InChIKey is ZBLFEWHIFDDYQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24BN3O2/c1-25(30)27-16-13-24(14-17-27)21-8-5-15-26-22(21)28(23(24)29)20-11-9-19(10-12-20)18-6-3-2-4-7-18/h2-12,15,30H,13-14,16-17H2,1H3.
What are the key properties of methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid?
methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid has a molecular weight of 397.29 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[2'-oxo-1'-(4-phenylphenyl)spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridine]-1-yl]borinic acid is sourced from PubChem (CID 58318977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).