C19H39N — CID 58319374
1,2,2,3,3,4,4,5,5,6,6,7,7-tridecamethylazepane (PubChem CID 58319374) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,7-tridecamethylazepane.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,7-tridecamethylazepane |
|---|---|
| PubChem CID | 58319374 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7-tridecamethylazepane |
| SMILES | CN1C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C19H39N/c1-14(2)15(3,4)17(7,8)19(11,12)20(13)18(9,10)16(14,5)6/h1-13H3 |
| InChIKey | KOEWORXRZAGESM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |