C23H33ClO3S — CID 58319515
5-[3-[(1S,3R)-3-chloro-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 58319515) has the molecular formula C23H33ClO3S and a molecular weight of 425.03 g/mol. Its IUPAC name is 5-[3-[(1S,3R)-3-chloro-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1S,3R)-3-chloro-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58319515 |
| Molecular Formula | C23H33ClO3S |
| Molecular Weight | 425.03 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 5-[3-[(1S,3R)-3-chloro-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCC1(C(O)C/C=C/C2[C@@H](CCCc3ccc(C(=O)O)s3)CC[C@H]2Cl)CCC1 |
| InChI | InChI=1S/C23H33ClO3S/c1-2-23(14-5-15-23)21(25)9-4-8-18-16(10-12-19(18)24)6-3-7-17-11-13-20(28-17)22(26)27/h4,8,11,13,16,18-19,21,25H,2-3,5-7,9-10,12,14-15H2,1H3,(H,26,27)/b8-4+/t16-,18?,19+,21?/m0/s1 |
| InChIKey | GRPZFYSAUUVSHT-OPWMNIGJSA-N |
| XLogP | 6.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.03 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|