C22H19Cl3F3NO3 — CID 58319551
3-[4-(4-oxohexan-2-yl)phenyl]-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-1,3-oxazolidin-2-one (PubChem CID 58319551) has the molecular formula C22H19Cl3F3NO3 and a molecular weight of 508.75 g/mol. Its IUPAC name is 3-[4-(4-oxohexan-2-yl)phenyl]-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-(4-oxohexan-2-yl)phenyl]-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58319551 |
| Molecular Formula | C22H19Cl3F3NO3 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | 3-[4-(4-oxohexan-2-yl)phenyl]-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-1,3-oxazolidin-2-one |
| SMILES | CCC(=O)CC(C)c1ccc(N2CC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)OC2=O)cc1 |
| InChI | InChI=1S/C22H19Cl3F3NO3/c1-3-16(30)8-12(2)13-4-6-15(7-5-13)29-11-21(22(26,27)28,32-20(29)31)14-9-17(23)19(25)18(24)10-14/h4-7,9-10,12H,3,8,11H2,1-2H3 |
| InChIKey | LJRGZVNSLGZITI-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|