C50H87N3O5 — CID 58319804
N-butyl-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dioxopyrrolidin-3-yl]acetamide (PubChem CID 58319804) has the molecular formula C50H87N3O5 and a molecular weight of 810.26 g/mol. Its IUPAC name is N-butyl-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dioxopyrrolidin-3-yl]acetamide.
| Compound Name | N-butyl-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dioxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 58319804 |
| Molecular Formula | C50H87N3O5 |
| Molecular Weight | 810.26 g/mol |
| Exact Mass | 809.66 |
| IUPAC Name | N-butyl-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dioxopyrrolidin-3-yl]acetamide |
| SMILES | CCCCCCCCC1C(CCCCCC)CCC(CCCCCCCCN2C(=O)C=CC2=O)C1CCCCCCCCN1C(=O)CC(N(CCCC)C(C)=O)C1=O |
| InChI | InChI=1S/C50H87N3O5/c1-5-8-11-13-19-25-31-44-42(29-23-12-9-6-2)33-34-43(30-24-18-14-16-21-27-38-52-47(55)35-36-48(52)56)45(44)32-26-20-15-17-22-28-39-53-49(57)40-46(50(53)58)51(41(4)54)37-10-7-3/h35-36,42-46H,5-34,37-40H2,1-4H3 |
| InChIKey | JOFCNEJTSCIECZ-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.26 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|