About N,N-ditert-butyl-N'-methylmethanimidamide
N,N-ditert-butyl-N'-methylmethanimidamide (PubChem CID 58319996) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is N,N-ditert-butyl-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N,N-ditert-butyl-N'-methylmethanimidamide |
| PubChem CID | 58319996 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N,N-ditert-butyl-N'-methylmethanimidamide |
| SMILES | C/N=C/N(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H22N2/c1-9(2,3)12(8-11-7)10(4,5)6/h8H,1-7H3/b11-8+ |
| InChIKey | KBVARNCFBXSVJX-DHZHZOJOSA-N |
| XLogP | 2.54 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-ditert-butyl-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-ditert-butyl-N'-methylmethanimidamide?
The IUPAC name of N,N-ditert-butyl-N'-methylmethanimidamide (CID 58319996) is N,N-ditert-butyl-N'-methylmethanimidamide.
What is the SMILES notation for N,N-ditert-butyl-N'-methylmethanimidamide?
The canonical SMILES for N,N-ditert-butyl-N'-methylmethanimidamide is C/N=C/N(C(C)(C)C)C(C)(C)C.
What is the InChIKey of N,N-ditert-butyl-N'-methylmethanimidamide?
The InChIKey is KBVARNCFBXSVJX-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H22N2/c1-9(2,3)12(8-11-7)10(4,5)6/h8H,1-7H3/b11-8+.
What are the key properties of N,N-ditert-butyl-N'-methylmethanimidamide?
N,N-ditert-butyl-N'-methylmethanimidamide has a molecular weight of 170.30 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-ditert-butyl-N'-methylmethanimidamide is sourced from PubChem (CID 58319996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).