C10H14F9O3P — CID 58320049
2-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(1,1,1-trifluoropropan-2-yloxy)phosphoryl]-2-methylpropane (PubChem CID 58320049) has the molecular formula C10H14F9O3P and a molecular weight of 384.18 g/mol. Its IUPAC name is 2-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(1,1,1-trifluoropropan-2-yloxy)phosphoryl]-2-methylpropane.
| Compound Name | 2-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(1,1,1-trifluoropropan-2-yloxy)phosphoryl]-2-methylpropane |
|---|---|
| PubChem CID | 58320049 |
| Molecular Formula | C10H14F9O3P |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(1,1,1-trifluoropropan-2-yloxy)phosphoryl]-2-methylpropane |
| SMILES | CC(OP(=O)(OC(C(F)(F)F)C(F)(F)F)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H14F9O3P/c1-5(8(11,12)13)21-23(20,7(2,3)4)22-6(9(14,15)16)10(17,18)19/h5-6H,1-4H3 |
| InChIKey | SKYIBDPZFNNXHL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|