About 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide
2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide (PubChem CID 58320105) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide.
Molecular Properties
| Compound Name | 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide |
| PubChem CID | 58320105 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide |
| SMILES | CC(C)[N+]([O-])(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H23NO/c1-8(2)11(12,9(3)4)10(5,6)7/h8-9H,1-7H3 |
| InChIKey | SKPZJHJKYRKKPX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide?
The IUPAC name of 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide (CID 58320105) is 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide.
What is the SMILES notation for 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide?
The canonical SMILES for 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide is CC(C)[N+]([O-])(C(C)C)C(C)(C)C.
What is the InChIKey of 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide?
The InChIKey is SKPZJHJKYRKKPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO/c1-8(2)11(12,9(3)4)10(5,6)7/h8-9H,1-7H3.
What are the key properties of 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide?
2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide has a molecular weight of 173.30 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N-di(propan-2-yl)propan-2-amine oxide is sourced from PubChem (CID 58320105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).