About 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone
1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone (PubChem CID 58320411) has the molecular formula C11H13ClFN3O
and a molecular weight of 257.70 g/mol. Its IUPAC name is 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone |
| PubChem CID | 58320411 |
| Molecular Formula | C11H13ClFN3O |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone |
| SMILES | CC(=O)[C@H]1CCC[C@@H]1Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C11H13ClFN3O/c1-6(17)7-3-2-4-9(7)15-10-8(13)5-14-11(12)16-10/h5,7,9H,2-4H2,1H3,(H,14,15,16)/t7-,9+/m1/s1 |
| InChIKey | SBYCJVSYLGMTID-APPZFPTMSA-N |
| XLogP | 2.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone?
The IUPAC name of 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone (CID 58320411) is 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone.
What is the SMILES notation for 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone?
The canonical SMILES for 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone is CC(=O)[C@H]1CCC[C@@H]1Nc1nc(Cl)ncc1F.
What is the InChIKey of 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone?
The InChIKey is SBYCJVSYLGMTID-APPZFPTMSA-N. The full InChI is InChI=1S/C11H13ClFN3O/c1-6(17)7-3-2-4-9(7)15-10-8(13)5-14-11(12)16-10/h5,7,9H,2-4H2,1H3,(H,14,15,16)/t7-,9+/m1/s1.
What are the key properties of 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone?
1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone has a molecular weight of 257.70 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclopentyl]ethanone is sourced from PubChem (CID 58320411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).