C15H9F6NO2 — CID 58320762
3,4,5,6,7,8-hexafluoro-1-(4-hydroxybutyl)benzo[cd]indol-2-one (PubChem CID 58320762) has the molecular formula C15H9F6NO2 and a molecular weight of 349.23 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexafluoro-1-(4-hydroxybutyl)benzo[cd]indol-2-one.
| Compound Name | 3,4,5,6,7,8-hexafluoro-1-(4-hydroxybutyl)benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 58320762 |
| Molecular Formula | C15H9F6NO2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 3,4,5,6,7,8-hexafluoro-1-(4-hydroxybutyl)benzo[cd]indol-2-one |
| SMILES | O=C1c2c(F)c(F)c(F)c3c(F)c(F)c(F)c(c23)N1CCCCO |
| InChI | InChI=1S/C15H9F6NO2/c16-8-6-5-7(10(18)11(8)19)15(24)22(3-1-2-4-23)14(5)13(21)12(20)9(6)17/h23H,1-4H2 |
| InChIKey | IZPAMRUADQLGFH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|