About 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene
2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene (PubChem CID 58320956) has the molecular formula C36H20F4S3
and a molecular weight of 624.75 g/mol. Its IUPAC name is 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene.
Molecular Properties
| Compound Name | 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene |
| PubChem CID | 58320956 |
| Molecular Formula | C36H20F4S3 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.07 |
| IUPAC Name | 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene |
| SMILES | Fc1cc(F)cc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(-c7cc(F)cc(F)c7)cc6)s5)s4)s3)cc2)c1 |
| InChI | InChI=1S/C36H20F4S3/c37-27-15-25(16-28(38)19-27)21-1-5-23(6-2-21)31-9-11-33(41-31)35-13-14-36(43-35)34-12-10-32(42-34)24-7-3-22(4-8-24)26-17-29(39)20-30(40)18-26/h1-20H |
| InChIKey | PKTNIVSNMIZNOS-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene?
The IUPAC name of 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene (CID 58320956) is 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene.
What is the SMILES notation for 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene?
The canonical SMILES for 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene is Fc1cc(F)cc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(-c7cc(F)cc(F)c7)cc6)s5)s4)s3)cc2)c1.
What is the InChIKey of 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene?
The InChIKey is PKTNIVSNMIZNOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H20F4S3/c37-27-15-25(16-28(38)19-27)21-1-5-23(6-2-21)31-9-11-33(41-31)35-13-14-36(43-35)34-12-10-32(42-34)24-7-3-22(4-8-24)26-17-29(39)20-30(40)18-26/h1-20H.
What are the key properties of 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene?
2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene has a molecular weight of 624.75 g/mol, XLogP of 12.43, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[5-[4-(3,5-difluorophenyl)phenyl]thiophen-2-yl]thiophene is sourced from PubChem (CID 58320956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).