About [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate
[(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate (PubChem CID 58320966) has the molecular formula C9H15FO2S
and a molecular weight of 206.28 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate.
Analyze [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate?
The IUPAC name of [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate (CID 58320966) is [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate.
What is the SMILES notation for [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate?
The canonical SMILES for [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate is CC[C@H]1S[C@@H](OC(C)=O)[C@@H](F)[C@@H]1C.
What is the InChIKey of [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate?
The InChIKey is DGJHEQFYYZBDNP-BUJSFMDZSA-N. The full InChI is InChI=1S/C9H15FO2S/c1-4-7-5(2)8(10)9(13-7)12-6(3)11/h5,7-9H,4H2,1-3H3/t5-,7-,8+,9-/m1/s1.
What are the key properties of [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate?
[(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate has a molecular weight of 206.28 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S,4S,5R)-5-ethyl-3-fluoro-4-methylthiolan-2-yl] acetate is sourced from PubChem (CID 58320966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).