C41H41ClN2O3S — CID 58321355
(2E)-2-[(2E)-2-[2-chloro-3-[(E)-2-(1,1,3,7-tetramethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,1,3-trimethylbenzo[e]indole-7-sulfonate (PubChem CID 58321355) has the molecular formula C41H41ClN2O3S and a molecular weight of 677.31 g/mol. Its IUPAC name is (2E)-2-[(2E)-2-[2-chloro-3-[(E)-2-(1,1,3,7-tetramethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,1,3-trimethylbenzo[e]indole-7-sulfonate.
| Compound Name | (2E)-2-[(2E)-2-[2-chloro-3-[(E)-2-(1,1,3,7-tetramethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,1,3-trimethylbenzo[e]indole-7-sulfonate |
|---|---|
| PubChem CID | 58321355 |
| Molecular Formula | C41H41ClN2O3S |
| Molecular Weight | 677.31 g/mol |
| Exact Mass | 676.25 |
| IUPAC Name | (2E)-2-[(2E)-2-[2-chloro-3-[(E)-2-(1,1,3,7-tetramethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,1,3-trimethylbenzo[e]indole-7-sulfonate |
| SMILES | Cc1ccc2c3c(ccc2c1)[N+](C)=C(/C=C/C1=C(Cl)/C(=C/C=C2/N(C)c4ccc5cc(S(=O)(=O)[O-])ccc5c4C2(C)C)CCC1)C3(C)C |
| InChI | InChI=1S/C41H41ClN2O3S/c1-25-11-17-31-28(23-25)12-19-33-37(31)40(2,3)35(43(33)6)21-14-26-9-8-10-27(39(26)42)15-22-36-41(4,5)38-32-18-16-30(48(45,46)47)24-29(32)13-20-34(38)44(36)7/h11-24H,8-10H2,1-7H3 |
| InChIKey | ZJGGCOYBLQARBD-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.31 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|