C39H24N5O8Ru — CID 58321400
(7-formyloxy-1,10-phenanthrolin-4-yl) formate;1,10-phenanthroline-4,7-dicarboxylic acid;2-phenylpyridine;ruthenium(1+) (PubChem CID 58321400) has the molecular formula C39H24N5O8Ru and a molecular weight of 791.72 g/mol. Its IUPAC name is (7-formyloxy-1,10-phenanthrolin-4-yl) formate;1,10-phenanthroline-4,7-dicarboxylic acid;2-phenylpyridine;ruthenium(1+).
| Compound Name | (7-formyloxy-1,10-phenanthrolin-4-yl) formate;1,10-phenanthroline-4,7-dicarboxylic acid;2-phenylpyridine;ruthenium(1+) |
|---|---|
| PubChem CID | 58321400 |
| Molecular Formula | C39H24N5O8Ru |
| Molecular Weight | 791.72 g/mol |
| Exact Mass | 792.07 |
| IUPAC Name | (7-formyloxy-1,10-phenanthrolin-4-yl) formate;1,10-phenanthroline-4,7-dicarboxylic acid;2-phenylpyridine;ruthenium(1+) |
| SMILES | O=C(O)c1ccnc2c1ccc1c(C(=O)O)ccnc12.O=COc1ccnc2c1ccc1c(OC=O)ccnc12.[Ru+].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/2C14H8N2O4.C11H8N.Ru/c17-7-19-11-3-5-15-13-9(11)1-2-10-12(20-8-18)4-6-16-14(10)13;17-13(18)9-3-5-15-11-7(9)1-2-8-10(14(19)20)4-6-16-12(8)11;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8H;1-6H,(H,17,18)(H,19,20);1-6,8-9H;/q;;-1;+1 |
| InChIKey | WFKKCKJUYLEMFV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 191.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.72 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|