C35H24N5O8Ru — CID 58321403
2-(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;[2-(4-formyloxy-2-pyridinyl)-4-pyridinyl] formate;2-phenylpyridine;ruthenium(1+) (PubChem CID 58321403) has the molecular formula C35H24N5O8Ru and a molecular weight of 743.67 g/mol. Its IUPAC name is 2-(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;[2-(4-formyloxy-2-pyridinyl)-4-pyridinyl] formate;2-phenylpyridine;ruthenium(1+).
| Compound Name | 2-(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;[2-(4-formyloxy-2-pyridinyl)-4-pyridinyl] formate;2-phenylpyridine;ruthenium(1+) |
|---|---|
| PubChem CID | 58321403 |
| Molecular Formula | C35H24N5O8Ru |
| Molecular Weight | 743.67 g/mol |
| Exact Mass | 744.07 |
| IUPAC Name | 2-(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;[2-(4-formyloxy-2-pyridinyl)-4-pyridinyl] formate;2-phenylpyridine;ruthenium(1+) |
| SMILES | O=C(O)c1ccnc(-c2cc(C(=O)O)ccn2)c1.O=COc1ccnc(-c2cc(OC=O)ccn2)c1.[Ru+].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/2C12H8N2O4.C11H8N.Ru/c15-7-17-9-1-3-13-11(5-9)12-6-10(18-8-16)2-4-14-12;15-11(16)7-1-3-13-9(5-7)10-6-8(12(17)18)2-4-14-10;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8H;1-6H,(H,15,16)(H,17,18);1-6,8-9H;/q;;-1;+1 |
| InChIKey | IGQIUNUNTLQMMK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 191.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|