C16H22N2O4S3 — CID 58321487
2-[(2E)-2-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-4-oxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 58321487) has the molecular formula C16H22N2O4S3 and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-[(2E)-2-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-4-oxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(2E)-2-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-4-oxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 58321487 |
| Molecular Formula | C16H22N2O4S3 |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-[(2E)-2-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-4-oxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCCCCCCCN1C(=O)/C(=C2\SCC(=O)N2CC(=O)O)SC1=S |
| InChI | InChI=1S/C16H22N2O4S3/c1-2-3-4-5-6-7-8-17-14(22)13(25-16(17)23)15-18(9-12(20)21)11(19)10-24-15/h2-10H2,1H3,(H,20,21)/b15-13+ |
| InChIKey | JJTXLCOJTRKSOG-FYWRMAATSA-N |
| XLogP | 3.04 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|