C18H18N3O6+ — CID 58321711
3-[2-[(1E,3Z,5Z)-3-cyano-5-[3-(2-formyloxyethyl)-1,3-oxazol-2-ylidene]penta-1,3-dienyl]-1,3-oxazol-3-ium-3-yl]propanoic acid (PubChem CID 58321711) has the molecular formula C18H18N3O6+ and a molecular weight of 372.36 g/mol. Its IUPAC name is 3-[2-[(1E,3Z,5Z)-3-cyano-5-[3-(2-formyloxyethyl)-1,3-oxazol-2-ylidene]penta-1,3-dienyl]-1,3-oxazol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[2-[(1E,3Z,5Z)-3-cyano-5-[3-(2-formyloxyethyl)-1,3-oxazol-2-ylidene]penta-1,3-dienyl]-1,3-oxazol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58321711 |
| Molecular Formula | C18H18N3O6+ |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-[2-[(1E,3Z,5Z)-3-cyano-5-[3-(2-formyloxyethyl)-1,3-oxazol-2-ylidene]penta-1,3-dienyl]-1,3-oxazol-3-ium-3-yl]propanoic acid |
| SMILES | N#CC(=C\C=C1/OC=CN1CCOC=O)/C=C/c1occ[n+]1CCC(=O)O |
| InChI | InChI=1S/C18H17N3O6/c19-13-15(1-3-16-20(8-11-26-16)6-5-18(23)24)2-4-17-21(9-12-27-17)7-10-25-14-22/h1-4,8-9,11-12,14H,5-7,10H2/p+1 |
| InChIKey | BAGZIRRLGHCCPA-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|