About 2-methylidene-1,3-benzoxazol-1-ium
2-methylidene-1,3-benzoxazol-1-ium (PubChem CID 58321825) has the molecular formula C8H6NO+
and a molecular weight of 132.14 g/mol. Its IUPAC name is 2-methylidene-1,3-benzoxazol-1-ium.
Molecular Properties
| Compound Name | 2-methylidene-1,3-benzoxazol-1-ium |
| PubChem CID | 58321825 |
| Molecular Formula | C8H6NO+ |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 2-methylidene-1,3-benzoxazol-1-ium |
| SMILES | C=C1N=c2ccccc2=[O+]1 |
| InChI | InChI=1S/C8H6NO/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5H,1H2/q+1 |
| InChIKey | UYMVCCZRGHJDMY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 23.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-1,3-benzoxazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-1,3-benzoxazol-1-ium?
The IUPAC name of 2-methylidene-1,3-benzoxazol-1-ium (CID 58321825) is 2-methylidene-1,3-benzoxazol-1-ium.
What is the SMILES notation for 2-methylidene-1,3-benzoxazol-1-ium?
The canonical SMILES for 2-methylidene-1,3-benzoxazol-1-ium is C=C1N=c2ccccc2=[O+]1.
What is the InChIKey of 2-methylidene-1,3-benzoxazol-1-ium?
The InChIKey is UYMVCCZRGHJDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6NO/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5H,1H2/q+1.
What are the key properties of 2-methylidene-1,3-benzoxazol-1-ium?
2-methylidene-1,3-benzoxazol-1-ium has a molecular weight of 132.14 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-1,3-benzoxazol-1-ium is sourced from PubChem (CID 58321825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).