C19H16N2O4S4 — CID 58322013
ethyl 2-cyano-2-[6-(1-isocyanopropylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-2-ylidene]acetate (PubChem CID 58322013) has the molecular formula C19H16N2O4S4 and a molecular weight of 464.62 g/mol. Its IUPAC name is ethyl 2-cyano-2-[6-(1-isocyanopropylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-2-ylidene]acetate.
| Compound Name | ethyl 2-cyano-2-[6-(1-isocyanopropylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-2-ylidene]acetate |
|---|---|
| PubChem CID | 58322013 |
| Molecular Formula | C19H16N2O4S4 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | ethyl 2-cyano-2-[6-(1-isocyanopropylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-2-ylidene]acetate |
| SMILES | [C-]#[N+]C(CC)=C1Sc2c(OC)c3c(c(OC)c2S1)SC(=C(C#N)C(=O)OCC)S3 |
| InChI | InChI=1S/C19H16N2O4S4/c1-6-10(21-3)19-28-15-11(23-4)13-14(12(24-5)16(15)29-19)27-18(26-13)9(8-20)17(22)25-7-2/h6-7H2,1-2,4-5H3/b18-9-,19-10- |
| InChIKey | QEZCCICTVWNHBR-JZAWIKSFSA-N |
| XLogP | 5.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|