C68H48F4N2 — CID 58322393
1-N,6-N-bis[3,5-bis(3-fluorophenyl)phenyl]-1-N,6-N-bis(3,5-dimethylphenyl)pyrene-1,6-diamine (PubChem CID 58322393) has the molecular formula C68H48F4N2 and a molecular weight of 969.14 g/mol. Its IUPAC name is 1-N,6-N-bis[3,5-bis(3-fluorophenyl)phenyl]-1-N,6-N-bis(3,5-dimethylphenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[3,5-bis(3-fluorophenyl)phenyl]-1-N,6-N-bis(3,5-dimethylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 58322393 |
| Molecular Formula | C68H48F4N2 |
| Molecular Weight | 969.14 g/mol |
| Exact Mass | 968.38 |
| IUPAC Name | 1-N,6-N-bis[3,5-bis(3-fluorophenyl)phenyl]-1-N,6-N-bis(3,5-dimethylphenyl)pyrene-1,6-diamine |
| SMILES | Cc1cc(C)cc(N(c2cc(-c3cccc(F)c3)cc(-c3cccc(F)c3)c2)c2ccc3ccc4c(N(c5cc(C)cc(C)c5)c5cc(-c6cccc(F)c6)cc(-c6cccc(F)c6)c5)ccc5ccc2c3c54)c1 |
| InChI | InChI=1S/C68H48F4N2/c1-41-25-42(2)28-59(27-41)73(61-37-51(47-9-5-13-55(69)33-47)31-52(38-61)48-10-6-14-56(70)34-48)65-23-19-45-18-22-64-66(24-20-46-17-21-63(65)67(45)68(46)64)74(60-29-43(3)26-44(4)30-60)62-39-53(49-11-7-15-57(71)35-49)32-54(40-62)50-12-8-16-58(72)36-50/h5-40H,1-4H3 |
| InChIKey | OSSHUAZTUFVBQM-UHFFFAOYSA-N |
| XLogP | 19.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.14 |
| LogP ≤ 5 | 19.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|