C30H20N4 — CID 58322553
3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoline (PubChem CID 58322553) has the molecular formula C30H20N4 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoline.
| Compound Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoline |
|---|---|
| PubChem CID | 58322553 |
| Molecular Formula | C30H20N4 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cnc5ccccc5c4)cc3)n2)cc1 |
| InChI | InChI=1S/C30H20N4/c1-3-9-22(10-4-1)28-32-29(23-11-5-2-6-12-23)34-30(33-28)24-17-15-21(16-18-24)26-19-25-13-7-8-14-27(25)31-20-26/h1-20H |
| InChIKey | WPILGRPPKGQBJN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |