About 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine
4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine (PubChem CID 58322594) has the molecular formula C40H26N4
and a molecular weight of 562.68 g/mol. Its IUPAC name is 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine.
Molecular Properties
| Compound Name | 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine |
| PubChem CID | 58322594 |
| Molecular Formula | C40H26N4 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cc5ccccc5c5ccccc45)nc(-c4ccc(-c5ccccn5)cc4)n3)cc2)nc1 |
| InChI | InChI=1S/C40H26N4/c1-2-10-32-31(9-1)25-35(34-12-4-3-11-33(32)34)39-26-38(29-17-15-27(16-18-29)36-13-5-7-23-41-36)43-40(44-39)30-21-19-28(20-22-30)37-14-6-8-24-42-37/h1-26H |
| InChIKey | OLKVEOZWDAGNGB-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine?
The IUPAC name of 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine (CID 58322594) is 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine.
What is the SMILES notation for 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine?
The canonical SMILES for 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine is c1ccc(-c2ccc(-c3cc(-c4cc5ccccc5c5ccccc45)nc(-c4ccc(-c5ccccn5)cc4)n3)cc2)nc1.
What is the InChIKey of 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine?
The InChIKey is OLKVEOZWDAGNGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H26N4/c1-2-10-32-31(9-1)25-35(34-12-4-3-11-33(32)34)39-26-38(29-17-15-27(16-18-29)36-13-5-7-23-41-36)43-40(44-39)30-21-19-28(20-22-30)37-14-6-8-24-42-37/h1-26H.
What are the key properties of 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine?
4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine has a molecular weight of 562.68 g/mol, XLogP of 9.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenanthren-9-yl-2,6-bis(4-pyridin-2-ylphenyl)pyrimidine is sourced from PubChem (CID 58322594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).