C26H32N2 — CID 58322895
1-N,1-N,6-N,6-N-tetraethyl-3,8-dimethylpyrene-1,6-diamine (PubChem CID 58322895) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-N,1-N,6-N,6-N-tetraethyl-3,8-dimethylpyrene-1,6-diamine.
| Compound Name | 1-N,1-N,6-N,6-N-tetraethyl-3,8-dimethylpyrene-1,6-diamine |
|---|---|
| PubChem CID | 58322895 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-N,1-N,6-N,6-N-tetraethyl-3,8-dimethylpyrene-1,6-diamine |
| SMILES | CCN(CC)c1cc(C)c2ccc3c(N(CC)CC)cc(C)c4ccc1c2c43 |
| InChI | InChI=1S/C26H32N2/c1-7-27(8-2)23-15-17(5)19-12-14-22-24(28(9-3)10-4)16-18(6)20-11-13-21(23)25(19)26(20)22/h11-16H,7-10H2,1-6H3 |
| InChIKey | FCQGLQFVWJSWBO-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|