C40H46B2N2O4 — CID 58323989
9-ethyl-3-[9-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 58323989) has the molecular formula C40H46B2N2O4 and a molecular weight of 640.44 g/mol. Its IUPAC name is 9-ethyl-3-[9-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 9-ethyl-3-[9-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 58323989 |
| Molecular Formula | C40H46B2N2O4 |
| Molecular Weight | 640.44 g/mol |
| Exact Mass | 640.36 |
| IUPAC Name | 9-ethyl-3-[9-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CCn1c2ccc(B3OC(C)(C)C(C)(C)O3)cc2c2cc(-c3ccc4c(c3)c3cc(B5OC(C)(C)C(C)(C)O5)ccc3n4CC)ccc21 |
| InChI | InChI=1S/C40H46B2N2O4/c1-11-43-33-17-13-25(21-29(33)31-23-27(15-19-35(31)43)41-45-37(3,4)38(5,6)46-41)26-14-18-34-30(22-26)32-24-28(16-20-36(32)44(34)12-2)42-47-39(7,8)40(9,10)48-42/h13-24H,11-12H2,1-10H3 |
| InChIKey | JHFALVDXCKAULX-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.44 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|