C23H27FN2O3S — CID 58324105
4-[2-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline (PubChem CID 58324105) has the molecular formula C23H27FN2O3S and a molecular weight of 430.55 g/mol. Its IUPAC name is 4-[2-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 58324105 |
| Molecular Formula | C23H27FN2O3S |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-[2-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cnc(-c3ccc(OCCOCCOCCF)cc3)s2)cc1 |
| InChI | InChI=1S/C23H27FN2O3S/c1-26(2)20-7-3-18(4-8-20)22-17-25-23(30-22)19-5-9-21(10-6-19)29-16-15-28-14-13-27-12-11-24/h3-10,17H,11-16H2,1-2H3 |
| InChIKey | MNIALDNAHUMGNE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|